2- Epi Docetaxel
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31077 |
| Alternative Name(s) | 2- Epi Docetaxel ;2’-epi-Taxotere;(αS,βS)-β-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-hydroxybenzenepropanoic Acid (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-12b-(Acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,6,11-trihydroxy-4a,8,13,13-tetramethyl-5 |
| Research Area | An impurity in commercial of Docetaxel.;Impurity in commercial preparations of Docetaxel |
| Molecular Formula | C43H53NO14 |
| CAS# | 133577-33-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O[C@@]1([C@](C[C@@H]2O)([H])OC1)[C@@]([C@@]2(C3=O)C)([H])[C@@H]([C@@](C4(C)C)(C[C@H](OC([C@@H](O)[C@H](C5=CC=CC=C5)NC(OC(C)(C)C)=O)=O)C(C)=C4[C@H]3O)O)OC(C6=CC=CC=C6)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31077.html |
| Additional Information | NULL |