Octanal-d4 | MedChemExpress (MCE)
Octanal-d4 is deuterated labeled Methyl vanillate (HY-75342). Methyl vanillate, one of the ingredients in Oryza sativa Linn., is a Wnt/β-catenin pathway activator[1]. A benzoate ester that is the methyl ester of vanillic acid. It has a role as an antioxidant and a plant metabolite.
| Trivial name | Octanal-d4 |
| Catalog Number | HY-N8015S2 |
| CAS# | 1335401-91-6 |
| Purity | ≥98.0% |
| SMILES | [2H]C([2H])C([2H])([2H])CCCCCC=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/octanal-d4.html |