Eugenol D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-54643 |
| Alternative Name(s) | 4-Allyl-2-methoxyphenol-D3; 4-Allylguenzene-D3; Allylgud3; Caryophyllic Acid-D3; Dentogum-D3; Eugenic Acid-D3; Eugenol-d3; NSC 209525-D3; NSC 8895-D3; p-Allylguaiacol-D3; p-Eugenol-D3. |
| Research Area | Labelled Eugenol is a dental compound which shows cytotoxicity to human oral squamous cell carcinoma and oral cells. When glucosylated, this compound exhibits anti-inflammatory activity. |
| Molecular Formula | C10H9D3O2 |
| CAS# | 1335401-17-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=CC=C(CC=C)C=C1OC([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54643.html |
| Additional Information | NULL |