Z-LLF-CHO | MedChemExpress (MCE)
Z-LLF-CHO (Z-Leu-Leu-Phe-CHO) is a potent inhibitor of the chymotrypsin-like activity of the pituitary multicatalytic proteinase complex (Ki = 460 nM). Z-LLF-CHO is also a NF-κB nuclear translocation inhibitor[1][2].
| Trivial name | Z-LLF-CHO |
| Catalog Number | HY-138096 |
| Alternative Name(s) | Z-Leu-Leu-Phe-CHO |
| Research Area | Cancer |
| CAS# | 133429-58-0 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@H](C=O)CC1=CC=CC=C1)[C@H](CC(C)C)NC([C@H](CC(C)C)NC(OCC2=CC=CC=C2)=O)=O |
| PubChem Chemical Structure ID | 10255743 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-llf-cho.html |