Z-LLY-FMK | MedChemExpress (MCE)
Z-LLY-FMK (Calpain Inhibitor IV) is a calpain inhibitor, involved in apoptosis of many cell systems. Z-LLY-FMK inhibits the intestine apoptosis after common bile duct ligation[1].
| Trivial name | Z-LLY-FMK |
| Catalog Number | HY-136750 |
| Alternative Name(s) | Calpain Inhibitor IV |
| Research Area | Cancer |
| CAS# | 133410-84-1 |
| Purity | ≥98.00% |
| SMILES | O=C(CF)[C@@H](NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC(OCC1=CC=CC=C1)=O)=O)=O)CC(C=C2)=CC=C2O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-lly-fmk.html |