KPT-185 | MedChemExpress (MCE)
KPT-185 is an orally bioavailable and selective inhibitor of CRM1 and displays potent antiproliferative properties at submicromolar concentrations (IC50=100-500 nM), induces apoptosis, cell-cycle arrest, and myeloid differentiation in AML cell lines and patient blasts[1].
| Trivial name | KPT-185 |
| Catalog Number | HY-15611 |
| Research Area | Cancer |
| CAS# | 1333151-73-7 |
| Purity | 98.21% |
| SMILES | O=C(OC(C)C)/C=C\N1N=C(C2=CC(C(F)(F)F)=CC(OC)=C2)N=C1 |
| PubChem Chemical Structure ID | 53495165 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/kpt-185.html |