KPT185 100mg
KPT185 is a selective CRM1 inhibitor. KPT-185 significantly inhibits leukemia cell proliferation with IC50 ranging from 100 nM to 500 nM, and induces cell-cycle arrest and apoptosis of AML cell lines and primary AML blasts.
| Trivial name | KPT185 100mg |
| Catalog Number | A12975-100 |
| Alternative Name(s) | (2Z)-3-[3-[3-Methoxy-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl]-2-Propenoic Acid 1-Methylethyl Ester |
| Molecular Formula | C16H16F3N3O3 |
| CAS# | 1333151-73-7 |
| SMILES | CC(C)OC(=O)C=CN1C=NC(=N1)C2=CC(=CC(=C2)OC)C(F)(F)F |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/kpt185.html |
