Quetiapine D4 fumarate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02767 |
| Alternative Name(s) | (2E)-but-2-enedioic acid; 2-[2-(4-{2-thia-9-azatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-10-yl}piperazin-1-yl)(1,1,2,2-D4)ethoxy]ethan-1-ol |
| Research Area | Labeled Quetiapine, intended for use as an internal standard for the quantification of Quetiapine by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H25D4N3O6S |
| CAS# | 1331636-50-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=C/C(O)=O)=O.OCCOC([2H])([2H])C([2H])([2H])N1CCN(C2=NC3=CC=CC=C3SC4=CC=CC=C24)CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02767.html |
| Additional Information | NULL |