Darifenacin Hydrobromide
Darifenacin hydrobromide is a M3-selective antagonist with pKi of 8.9, an anticholinergic and antispasmotic agent used to treat urinary incontinence and overactive bladder syndrome.
| Trivial name | UK-88525 Hydrobromide |
| Catalog Number | CSN16149 |
| Alternative Name(s) | UK-88525 Hydrobromide |
| Research Area | Neurological Disease |
| Molecular Formula | C28H31BrN2O2 |
| CAS# | 133099-07-7 |
| Purity | ≥98% |
| SMILES | O=C(C(C1=CC=CC=C1)([C@H]2CN(CC2)CCC3=CC4=C(C=C3)OCC4)C5=CC=CC=C5)N.Br |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/darifenacin-hydrobromide.html |
