Go6983
Go6983 is a pan-PKC inhibitor against for PKCα, PKCβ, PKCγ and PKCδ with IC50 of 7 nM, 7 nM, 6 nM and 10 nM, respectively and less potent to PKCζ and inactive to PKCμ.
| Trivial name | GOE 6983 |
| Catalog Number | CSN16527 |
| Alternative Name(s) | GOE 6983 |
| Research Area | Cancer |
| Molecular Formula | C26H26N4O3 |
| CAS# | 133053-19-7 |
| Purity | ≥99% |
| SMILES | O=C(C(C1=CN(CCCN(C)C)C2=C1C=C(OC)C=C2)=C3C4=CNC5=C4C=CC=C5)NC3=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/go6983.html |