(±)-Darifenacin
Darifenacin [(±)-UK-88525] is a potent, specific and competitive M3 selective receptor antagonist (M3 SRA) that has been shown to have high affinity and selectivity for the M3 receptor. It significantly improves major overactive bladder (OAB) symptoms with proven efficacy, tolerability, and safety.
| Trivial name | (±)-UK-88525 |
| Catalog Number | E6020 |
| Molecular Formula | C23H23N7O5 |
| CAS# | 133033-93-9 |
| Inchi | InChI=1S/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t 14?,16-/m0/s1 |
| Inchi Key | OGSBUKJUDHAQEA-WMCAAGNKSA-N |
| SMILES | C#CCC(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/darifenacin-e6020.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E6020-Darifenacin-chemical-structure.png |
