3-Indolebutyric acid 10mM * 1mL in DMSO
3-Indolebutyric acid is a plant hormone in the auxin family and is an ingredient in many commercial horticultural plant rooting products.
Trivial name | 3-Indolebutyric acid 10mM * 1mL in DMSO |
Catalog Number | A10013-10mM-D |
Alternative Name(s) | 1H-Indole-3-butanoic acid |
Molecular Formula | C12H13NO2 |
CAS# | 133-32-4 |
SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/3-indolebutyric-acid.html |