Piracetam D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11811 |
| Alternative Name(s) | 2-Oxo-1-pyrrolidietamide-d8; 2-(2-Oxopyrrolidin-1-ygilen-d8; Axonyl-d8; Cerebroforte-d8; Piramem-d8; Pyracetam-d8; UCB 6215-d8; |
| Research Area | Nootropic. Labeled Piracetam, intended for use as an internal standard for the quantification of Piracetam by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H2D8N2O2 |
| CAS# | 1329799-64-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C([2H])([2H])N(C([2H])([2H])C([2H])([2H])C1([2H])[2H])C1=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11811.html |
| Additional Information | NULL |