Xanthurenic Acid D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-62782 |
| Alternative Name(s) | 4,8-Dihydroxy-2-quinolinecarboxylic Acid-d4; 4,8-Dihydroxyquinaldic Acid-d4; 8-Hydroxykynurenic Acid-d4; NSC 401570-d4; Xanthuric Acid-d4; |
| Research Area | Labelled Xanthurenic Acid . Excreted by pyridoxine-deficient animals after the ingestion of tryptophan. |
| Molecular Formula | C10H3D4NO4 |
| CAS# | 1329611-28-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=C2C(O)=C([2H])C(C(O)=O)=N1)=C(C([2H])=C2[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62782.html |
| Additional Information | NULL |