Risperidone EP Impurity B
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-41865 |
| Alternative Name(s) | 3-[2-[4-[(Z)-(2,4-Difluorophenyl)(hydroxyimino)methyl]-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one;Risperidone Z-Oxime Impurity. |
| Research Area | Risperidone Z-Oxime is an impurity of Risperidone . Risperidone impurity per USP. ;Impurity in commercial preparations of Risperidone |
| Molecular Formula | C23H28F2N4O2 |
| CAS# | 132961-05-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O/N=C(C1CCN(CCC(C(N(CCCC2)C2=N3)=O)=C3C)CC1)C(C=CC(F)=C4)=C4F |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST41865.html |
| Additional Information | NULL |