Neohesperidin 500mg
Flavanone glycoside with neuroprotective and antioxidant properties. Does not inhibit oral carcinogenesis in a rat model unlike other citrus flavanones, but does exert a protective effect against gastritis and gastric lesions.
| Trivial name | Neohesperidin 500mg |
| Catalog Number | A10633-500 |
| Alternative Name(s) | (S)-4?€?-Methoxy-3?€?,5,7-trihydroxyflavanone-7-[2-O-(??-L-rhamnopyranosyl)-??-D-glucopyranoside] |
| Molecular Formula | C28H34O15 |
| CAS# | 13241-33-3 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)CO)O)O)O)O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/neohesperidin.html |
