Cilnidipine 250mg
Cilnidipine is a dual blocker of L-type voltage-gated calcium channels in vascular smooth muscle and N-type calcium channels in sympathetic nerve terminals that supply.
| Trivial name | Cilnidipine 250mg |
| Catalog Number | A10215-250 |
| Alternative Name(s) | O3-(2-methoxyethyl) O5-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine- 3,5-dicarboxylate |
| Molecular Formula | C27H28N2O7 |
| CAS# | 132203-70-4 |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC/C=C/C2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/cilnidipine.html |
