Carbamazepine D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03016 |
| Alternative Name(s) | NULL |
| Research Area | Carbamazepine Stable Isotope; Labeled Carbamazepine;Labeled Carbamazepine, intended for use as an internal standard for the quantification of Carbamazepine by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H12N2O |
| CAS# | 132183-78-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(N(C1=C2C([2H])=C([2H])C([2H])=C1[2H])C(C(C([2H])=C2[2H])=C3[2H])=C(C([2H])=C3[2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03016.html |
| Additional Information | NULL |