4-Isopropoxybenzoic acid | MedChemExpress (MCE)
4-Isopropoxybenzoic acid (p-Isopropoxybenzoic acid) is an aromatic carboxylic acid organic compound that can be used as a synthetic intermediate in organic synthesis such as pesticides[1].
| Trivial name | 4-Isopropoxybenzoic acid |
| Catalog Number | HY-75814 |
| Alternative Name(s) | p-Isopropoxybenzoic acid |
| Research Area | Others |
| CAS# | 13205-46-4 |
| Purity | 100.0% |
| SMILES | O=C(O)C1=CC=C(OC(C)C)C=C1 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/4-isopropoxybenzoic-acid.html |