Ramosetron
API Standard
| Catalog Number | CS-O-08098 |
| Alternative Name(s) | (R)-(1-methyl-1H-indol-3-yl)(4,5,6,7-tetrahydro-1H-benzo[d]imidazol-6-yl)methanone. |
| Research Area | Ramosetron is a serotonin 5-HT3 receptor antagonist for the treatment of nausea and vomiting. It is believed to have higher potency and longer antiemetic action than other 1st generation 5-HT3 antagonists such as ondansetron. Ramosetron is also indicated |
| Molecular Formula | C17H17N3O |
| CAS# | 132036-88-5 |
| Purity | >98% |
| SMILES | O=C([C@H]1CC(NC=N2)=C2CC1)C3=CN(C)C4=CC=CC=C34 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08098.html |