UNC 0631
G9a inhibitor Chromatin/Epigenetics|Histone Methyltransferase
| Catalog Number | B1127-5.1 |
| Research Area | Chromatin/Epigenetics|Histone Methyltransferase |
| Molecular Formula | C37H61N7O2 |
| CAS# | 1320288-19-4 |
| Purity | 98.1% |
| SMILES | COC1=C(OCCCN2CCCCC2)C=C3C(C(NC4CCN(CC5CCCCC5)CC4)=NC(N6CCN(C(C)C)CCC6)=N3)=C1 |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1127 |
