N-1-Naphthylphthalamic acid
N-1-Naphthylphthalamic acid (Alanap 1) is a modulator of polar auxin transport that competes with auxin (indole-3-acetic acid, IAA) for membrane binding sites. N-1-Naphthylphthalamic acid also disrupts maize leaf initiation, KNOX protein regulation, and leaf margin formation.
| Trivial name | Alanap 1 |
| Catalog Number | E7275 |
| Molecular Formula | C5H5N5S |
| CAS# | 132-66-1 |
| Inchi | InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
| Inchi Key | WYWHKKSPHMUBEB-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=S)N=C(N2)N |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/n-1-naphthylphthalamic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7275-n-1-naphthylphthalamic-acid-chemical-structure-tube.png |