Tacrolimus Impurity 2
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-54717 |
| Alternative Name(s) | (E/Z)-FK-506 26,28-Allylic Ester Rearrangement Impurity.;bis(1,16-dihydroxy-12-(4-hydroxy-3-methoxycyclohexyl)-25,27-dimethoxy-13,15,21,23,29-pentamethyl-19-(prop-2-en-1-yl)-11,30-dioxa-4-azatricyclo[24.3.1.04,?]triaconta-13,20-diene-2,3,10,18-tetrone) bi |
| Research Area | FK-506 impurity. A new macrolite of thermal rearrangement of the immunosuppressant FK-506. |
| Molecular Formula | C44H69NO12 |
| CAS# | 131944-48-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CO[C@@H]1[C@]([C@H](C[C@H](C/C(C)=C[C@H]2CC=C)C)OC)([H])O[C@@](O)(C(C(N(CCCC3)[C@]3([H])C(O[C@@]([C@@](CC[C@H]4O)([H])C[C@H]4OC)([H])/C(C)=C/[C@H](C)[C@@H](O)CC2=O)=O)=O)=O)[C@H](C)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54717.html |
| Additional Information | NULL |
