Lansoprazole sulfone | MedChemExpress (MCE)
Lansoprazole sulfone (AG-1813) is an orally active and selective inhibitor of H+, K+-ATPase. Lansoprazole sulfone can significantly stimulates gastric acid secretion by inhibiting H+, K+-ATPase. Lansoprazole sulfone has potential applications in duodenal ulcer, gastric ulcer, gastroesophageal reflux disease and Zolinger Ellison disease[1][2].
| Trivial name | Lansoprazole sulfone |
| Catalog Number | HY-W008614 |
| Alternative Name(s) | AG-1813 |
| Research Area | Metabolic Disease |
| CAS# | 131926-99-3 |
| Purity | 99.52% |
| SMILES | O=S(C1=NC2=CC=CC=C2N1)(CC3=NC=CC(OCC(F)(F)F)=C3C)=O |
| PubChem Chemical Structure ID | 10385385 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/lansoprazole-sulfone.html |