Metronidazole Benzoate (Standard) | MedChemExpress (MCE)
Metronidazole Benzoate (Standard) is the analytical standard of Metronidazole Benzoate. This product is intended for research and analytical applications. Metronidazole Benzoate, derives from a metronidazole and a benzoic acid, has a role as an antibacterial, antimicrobial, antiparasitic, and antitrichomonal agent[1].
| Trivial name | Metronidazole Benzoate (Standard) |
| Catalog Number | HY-122975R |
| Alternative Name(s) | Benzoyl metronidazole (Standard) |
| Research Area | Infection |
| CAS# | 13182-89-3 |
| Purity | ≥98.0% |
| SMILES | O=[N+](C1=CN=C(C)N1CCOC(C2=CC=CC=C2)=O)[O-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/metronidazole-benzoate-standard.html |