Famoxadone
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-54658 |
| Alternative Name(s) | Famoxate; DPX-JE 874; 5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione; |
| Research Area | Famoxadone is a known fungicide used in the protection of agricultural products against various fungal diseases and other biotic stresses such as pests. |
| Molecular Formula | C22H18N2O4 |
| CAS# | 131807-57-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(OC1=O)(C2=CC=C(OC3=CC=CC=C3)C=C2)C(N1NC4=CC=CC=C4)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54658.html |
| Additional Information | NULL |