Arbidol HCl 10mg
Arbidol is an antiviral treatment for influenza infection used in Russia and China. Arbidol inhibits membrane fusion. Arbidol prevents contact between the virus and target host cells. Fusion between the viral capsid and the cell membrane of the target cell is inhibited. This prevents viral entry to the target cell, and therefore protects it from infection.
| Trivial name | Arbidol HCl 10mg |
| Catalog Number | A11663-10 |
| Alternative Name(s) | 6-Bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-[(phenylthio)methyl]-1H-indole-3-carboxylic acid ethyl ester monohydrochloride |
| Molecular Formula | C22H25BrN2O3S.HCl |
| CAS# | 131707-23-8 |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C(=C21)CN(C)C)O)Br)C)CSC3=CC=CC=C3.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/arbidol-hcl.html |
