EMA401
EMA401, a highly selective AT2R antagonist, inhibition of augmented AngII/AT2R induced p38 and p42/p44 MAPK activation, and hence inhibition of DRG neuron hyperexcitability and sprouting of DRG neurons.
| Trivial name | / |
| Catalog Number | CSN18823 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C32H29NO5 |
| CAS# | 1316755-16-4 |
| Purity | ≥99% |
| SMILES | O=C([C@H]1N(C(C(C2=CC=CC=C2)C3=CC=CC=C3)=O)CC4=C(C(OCC5=CC=CC=C5)=C(OC)C=C4)C1)O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/ema401.html |