(-)-WIN 55,212-3 mesylate
(−)-WIN 55,212-3 is an aminoalkylindole derivative which acts as a competitive neutral antagonist of the human cannabinoid CB2 receptor and presumably express the CB1 receptor. It also weakly antagonizes the melatonin MT1 and muscarinic M4 receptors but has no effect on several other G protein-coupled receptors.
Catalog Number | 131543-25-4 |
Alternative Name(s) | [(11S)-2-methyl-11-(morpholin-4-ylmethyl)-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-naphthalen-1-ylmethanone mesylate |
Molecular Formula | C24H37NO3 |
CAS# | 131543-25-4 |
Purity | ≥98% |
Inchi | InChI=1S/C27H26N2O3.CH4O3S/c1-18-25(27(30)22-9-4-7-19-6-2-3-8-21(19)22)23-10-5-11-24-26(23)29(18)20(17-32-24)16-28-12-14-31-15-13-28;1-5(2,3)4/h2-11,20H,12-17H2,1H3;1H3,(H,2,3,4)/t20-;/m0./s1 |
Inchi Key | FSGCSTPOPBJYSX-BDQAORGHSA-N |
Size | Please inquire |
Supplier Page | https://www.bocsci.com/win-55-212-3-mesylate-cas-131543-25-4-item-235722.html |