TMP 269 5mg
TMP 269 is a potent, selective class IIa HDAC inhibitor with IC50 of 157 nM, 97 nM, 43 nM and 23 nM for HDAC4, HDAC5, HDAC7 and HDAC9, respectively.
| Trivial name | TMP 269 5mg |
| Catalog Number | A14128-5 |
| Alternative Name(s) | N-((4-(4-phenylthiazol-2-yl)tetrahydro-2H-pyran-4-yl)methyl)-3-(5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzamide |
| Molecular Formula | C25H21F3N4O3S |
| CAS# | 1314890-29-3 |
| SMILES | O=C(c1cccc(c1)c1noc(n1)C(F)(F)F)NCC1(CCOCC1)c1scc(n1)c1ccccc1 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tmp-269.html |
