Cercosporamide 1mg
Cercosporamide, an usnic amide, was originally identified in Cercosporidium henningsii as a host-selective phytotoxin and broad-spectrum antifungal agent and is a potent inhibitor of MAP-kinase interacting kinase-2 (Mnk2; IC50 = 11 nM), JAK3 (IC50 = 31), and Mnk1 (IC50 = 116 nM).
Trivial name | Cercosporamide 1mg |
Catalog Number | A15362-1 |
Alternative Name(s) | (9aS)-8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-carboxamide |
Molecular Formula | C16H13NO7 |
CAS# | 131436-22-1 |
SMILES | CC(=O)C1=C(C=C2C(C1=O)(C3=C(C=C(C(=C3O2)C(=O)N)O)O)C)O |
Size | 1mg |
Supplier Page | http://www.adooq.com/cercosporamide.html |