UNC 669 10mM * 1mL in DMSO
UNC669 is a small-molecule antagonist of methyl-lysine (KMe) reader protein with selectivity for L3MBTL1 and L3MBTL3 (IC50 of 4.2??M and 3.1??M respectively)
| Trivial name | UNC 669 10mM * 1mL in DMSO |
| Catalog Number | A13717-10mM-D |
| Alternative Name(s) | (5-bromopyridin-3-yl)(4-(pyrrolidin-1-yl)piperidin-1-yl)methanone |
| Molecular Formula | C15H20BrN3O |
| CAS# | 1314241-44-5 |
| SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC(=CN=C3)Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/unc-669.html |
