N-Methyl Leukotriene C4 | MedChemExpress (MCE)
N-Methyl Leukotriene C4 stimulates contraction of airway smooth muscle in animals, with efficacy varying by tissue and species. For example, it can stimulate the lungs of bullfrogs to contract[1].
| Trivial name | N-Methyl Leukotriene C4 |
| Catalog Number | HY-134092 |
| Alternative Name(s) | N-Methyl-LTC4 |
| Research Area | Inflammation/Immunology |
| CAS# | 131391-65-6 |
| Purity | ≥98.0% |
| SMILES | OC(CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC)SC[C@@H](C(NCC(O)=O)=O)NC(CC[C@H](NC)C(O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-methyl-leukotriene-c4.html |