MDL 27399 | MedChemExpress (MCE)
MDL 27399 is an inhibitor of human neutrophil cathepsin G (Ki = 7 μM). MDL 27399 can be used for research of inflammatory diseases[1].
| Trivial name | MDL 27399 |
| Catalog Number | HY-123753 |
| Research Area | Inflammation/Immunology |
| CAS# | 131374-22-6 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](NC([C@H]1N(CCC1)C([C@@H](NC([C@@H](NC(CCC(OC)=O)=O)C)=O)C)=O)=O)CC2=CC=CC=C2)OC |
| PubChem Chemical Structure ID | 5487372 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mdl-27399.html |