Periplocin
Periplocin is a cardiotonic steroid isolated from Periploca forrestii. Periplocin promotes tumor cell apoptosis and inhibits tumor growth. Periplocin has the potential to facilitate wound healing through the activation of Src/ERK and PI3K/Akt pathways mediated by Na/K-ATPase .
| Trivial name | / |
| Catalog Number | CSN25211 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C36H56O13 |
| CAS# | 13137-64-9 |
| Purity | ≥97% |
| SMILES | O=C1OCC([C@H]2CC[C@]3(O)[C@]4([H])CC[C@]5(O)C[C@@H](O[C@H]6C[C@H](OC)[C@H](O[C@H]7[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O7)[C@@H](C)O6)CC[C@]5(C)[C@@]4([H])CC[C@]23C)=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/periplocin.html |