Cy 3 (Non-Sulfonated) (potassium) | MedChemExpress (MCE)
Cy 3 (Non-Sulfonated) potassium belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cy 3 (Non-Sulfonated) (potassium) |
| Catalog Number | HY-D0968A |
| Alternative Name(s) | Cyanine3 potassium |
| CAS# | 1311966-47-8 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC2=C([N+](CCCCCC(ON3C(CCC3=O)=O)=O)=C(/C=C/C=C4N(CCCCCC(ON5C(CCC5=O)=O)=O)C6=C(C=C(S(=O)(O[K])=O)C=C6)C/4(C)C)C2(C)C)C=C1)([O-])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cy-3-non-sulfonated-potassium.html |