N-Acetylneuraminic acid
N-Acetylneuraminic acid (Neu5Ac, NeuAc, Acido aceneuramico, Acide aceneuramique, Acidium aceneuramicum, Sialic acid, NANA) is the predominant sialic acid found in mammalian cells. Sialic acids are negatively charged monosaccharides attached to the end of sugar chains, giving rise to a wide variety of glycoproteins and glycolipids in biological fluids and cell membranes.
| Trivial name | Neu5Ac, NeuAc, Acido aceneuramico, Acide aceneuramique, Acidium aceneuramicum, Sialic acid |
| Catalog Number | S4792 |
| Molecular Formula | C19H19Cl2N9O3 |
| CAS# | 131-48-6 |
| Inchi | InChI=1S/C19H19Cl2N9O3/c1-10(32-2)17(33-3)16-13(9-22-15-7-14(21)28-29(15)16)27-19(31)26-11-6-12(20)18(23-8-11)30-24-4-5-25-30/h4-10,17H,1-3H3,(H2,26,27,31)/t10-,17+/m1/s1 |
| Inchi Key | XKQLNDPUQSZBJW-QGHHPUGFSA-N |
| SMILES | CC(C(C1=C(C=NC2=CC(=NN21)Cl)NC(=O)NC3=CC(=C(N=C3)N4N=CC=N4)Cl)OC)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/n-acetylneuraminic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/n-acetylneuraminic-acid-chemical-structure-s4792.gif |
