H 89 2HCl
H 89 2HCl is a potent and selective inhibitor of cyclic AMP-dependent protein kinase (protein kinase A) with IC50 of 48 nM. It also shows weak inhibition on PKG, PKC, CK1, CK2 and others kinases.
| Trivial name | Protein Kinase Inhibitor |
| Catalog Number | CSN19160 |
| Alternative Name(s) | Protein Kinase Inhibitor |
| Research Area | / |
| Molecular Formula | C20H22BrCl2N3O2S |
| CAS# | 130964-39-5 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=CC2=C1C=CN=C2)(NCCNC/C=C/C3=CC=C(Br)C=C3)=O.[H]Cl.[H]Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/h-89-2hcl.html |
