Entacapone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30903 |
| Alternative Name(s) | (E)-Isomer of Entacapone polymorphic form A;(E)-2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide;Tamsulosin impurity. |
| Research Area | (E)-Isomer of Entacapone polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian |
| Molecular Formula | C14H15N3O5 |
| CAS# | 130929-57-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC)CC)/C(C#N)=C/C1=CC([N](=O)=O)=C(O)C(O)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30903.html |
| Additional Information | NULL |