Mesalamine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03065 |
| Alternative Name(s) | 5-amino-2-hydroxy(²H3)benzoic acid |
| Research Area | Labeled Mesalamine, intended for use as an internal standard for the quantification of Mesalamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H4D3NO3 |
| CAS# | 1309283-32-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C([2H])=C(N)C([2H])=C1[2H])=C1O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03065.html |
| Additional Information | NULL |