Orphenadrine D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10473 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Orphenadrine;Labeled Orphenadrine, intended for use as an internal standard for the quantification of Orphenadrine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H21D3ClNO |
| CAS# | 1309283-23-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=CC=C1)C(C2=CC=CC=C2)OCCN(C)C([2H])([2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10473.html |
| Additional Information | NULL |