Lanosta-7,9(11),23,25(27)-tetraen-26-oic acid, 23,27-epoxy-3-oxo- | MedChemExpress (MCE)
Lanosta-7,9(11),23,25(27)-tetraen-26-oic acid, 23,27-epoxy-3-oxo- is a lanosterane type compound. Lanosta-7,9(11),23,25(27)-tetraen-26-oic acid, 23,27-epoxy-3-oxo- can be isolated from Tu-Jin-Pi (the root bark of Pseudolarix kaempferi)[1].
| Trivial name | Lanosta-7,9(11),23,25(27)-tetraen-26-oic acid, 23,27-epoxy-3-oxo- |
| Catalog Number | HY-N10854 |
| Research Area | Others |
| CAS# | 130825-80-8 |
| Purity | ≥98.00% |
| SMILES | C[C@]12C3=CC[C@](C(C)(C(CC4)=O)C)([H])[C@@]4(C)C3=CC[C@@]1([C@@](CC2)([H])[C@H](C)CC5=CC(C(O)=O)=CO5)C |
| PubChem Chemical Structure ID | 14682645 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lanosta-7-9-11-23-25-27-tetraen-26-oic-acid-23-27-epoxy-3-oxo.html |