Dorzolomide HCl
Dorzolomide HCl is a potent and water-soluble inhibitor of human carbonic anhydrase II and IV with Ki of 1.9 nM and 31 nM respectively and used as anti-glaucoma agent.
| Trivial name | L671152 HCl;MK 507 HCl |
| Catalog Number | CSN10859 |
| Alternative Name(s) | L671152 HCl;MK 507 HCl |
| Research Area | / |
| Molecular Formula | C10H17ClN2O4S3 |
| CAS# | 130693-82-2 |
| Purity | ≥99% |
| SMILES | O=S(C(S1)=CC([C@@H](NCC)C[C@@H]2C)=C1S2(=O)=O)(N)=O.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dorzolomide-hcl.html |
