Dorzolamide HCL 25mg
Dorzolamide HCl is a carbonic anhydrase inhibitor. It is an anti-glaucoma agent and topically applied in the form of eye drops. Dorzolamide HCl is used to lower increased intraocular pressure in open-angle glaucoma and ocular hypertension.
| Trivial name | Dorzolamide HCL 25mg |
| Catalog Number | A10333-25 |
| Alternative Name(s) | (2S,4S)-2-Ethylamino-4-methyl-5,5-dioxo-5,7-dithiabicyclo[4.3.0]nona-8,10-diene-8-sulfonamide hydrochloride |
| Molecular Formula | C10H17ClN2O4S3 |
| CAS# | 130693-82-2 |
| SMILES | CCN[C@H]1C[C@@H](S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N)C.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/dorzolamide-hcl.html |