PD 123319 ditrifluoroacetate 50mg
PD 123319 ditrifluoroacetate is a potent, selective, non-peptide angiotensin AT2 receptor antagonist. IC50 values are 34 and 210 nM in rat adrenal tissue and brain respectively.
| Trivial name | PD 123319 ditrifluoroacetate 50mg |
| Catalog Number | A13201-50 |
| Alternative Name(s) | 1-[[4-(Dimethylamino)-3-methylpheny?l]methyl]-5-(diphenylacetyl)-4,5,6,7-tetrahydro-1H?-imidazo[4,5-c]pyridine-6-carboxylic acid ditrifluoroacetate |
| Molecular Formula | C31H32N4O3.2CF3CO2H |
| CAS# | 130663-39-7 |
| SMILES | CC1=C(C=CC(=C1)CN2C=NC3=C2C[C@H](N(C3)C(=O)C(C4=CC=CC=C4)C5=CC=CC=C5)C(=O)O)N(C)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/pd-123319-ditrifluoroacetate.html |
