Edoxaban D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11960 |
| Alternative Name(s) | N‐[(1S,2R,4S)‐4‐[bis(D3)met; methyl‐4H,5H,6H,7H‐[1,3]thiazolo[5,4R2‐ amido}cyclohexyl]‐N'‐(5‐chloropyridin‐2‐ yl)ethanediamide |
| Research Area | Labeled Edoxaban, intended for use as an internal standard for the quantification of Edoxabanby GC- or LC-mass spectrometry. |
| Molecular Formula | C24H24D6ClN7O4S |
| CAS# | 1304701-57-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=NC(CCN(C)C2)=C2S1)N[C@H](C[C@@H](C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])=O)CC3)[C@H]3NC(C(NC4=CC=C(Cl)C=N4)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11960.html |
| Additional Information | NULL |