Batimastat sodium salt 10mg
Batimastat is an anticancer drug that belongs to the family of drugs called angiogenesis inhibitors. Batimastat (BB-94) is a potent, broad spectrum matrix metalloprotease (MMP) inhibitor.
| Trivial name | Batimastat sodium salt 10mg |
| Catalog Number | A15326-10 |
| Alternative Name(s) | (2S,3R)-N-Hydroxy-N'-[(2S)-1-methylamino-1-oxo-3-phenylpropan-2-yl]-3-(2-methylpropyl)-2-(thiophen-2-ylsulfanylmethyl)butanediamide sodium salt |
| Molecular Formula | C23H30N3NaO4S2 |
| CAS# | 130464-84-5 |
| SMILES | CC(C)CC(C(CSC1=CC=CS1)C(=O)N[O-])C(=O)NC(CC2=CC=CC=C2)C(=O)NC.[Na+] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/batimastat-sodium-salt.html |
