(-)-Catechin gallate
(-)-Catechin gallate, a minor polyphenolic constituent in green tea, is used to study its cytotoxicity. It enhances Fe(2+)-induced, lipid peroxidation. It also inhibits aromatase activity, an enzyme that converts androgens to estrogen and is thought to play a role in the etiology of breast cancer.
| Catalog Number | B2703-464825 |
| Alternative Name(s) | (-)-CG; (-)-Catechin gallate; (2S,3R)-2-(3,4-Dihydroxyphenyl)-3-(3,4,5-trihydroxybenzoyloxy)-3,4-dihydro-2H-1-benzopyran-5,7-diol; 3,4,5-Trihydroxybenzoic acid [[(2S)-2β-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran]-3α-yl] ester |
| Molecular Formula | C22H18O10 |
| CAS# | 130405-40-2 |
| Purity | >98% |
| Inchi | InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21+/m1/s1 |
| Inchi Key | LSHVYAFMTMFKBA-CTNGQTDRSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/product/catechin-gallate-cas-130405-40-2-464825.html |
