MCPG sodium | MedChemExpress (MCE)
MCPG is a carboxylic phenyl glycine. MCPG can block metabotropic glutamate receptor (mGluR)(HY-15129) and has antagonistic activity of mGluR subtype. MCPG can be used to study the induction and maintenance of long-term potentiation (LTP) [1].
| Trivial name | MCPG sodium |
| Catalog Number | HY-103570 |
| Research Area | Neurological Disease |
| CAS# | 1303994-09-3 |
| Purity | ≥98.00% |
| SMILES | O=C(O[Na])C(C)(N)C1=CC=C(C(O)=O)C=C1 |
| PubChem Chemical Structure ID | 133698095 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mcpg-sodium.html |