Batimastat (BB-94) 25mg
Batimastat (BB-94) is a potent and synthetic inhibitor of a broad spectrum of matrix metalloproteinases (MMPs), including interstitial collagenase (IC50 = 3 nM), stromelysin (IC50 = 20 nM), Mr 72,000 type IV collagenase (IC50 = 4 nM), Mr 92,000 type IV collagenase (IC50 = 4 nM), and matrilysin (IC50 = 6 nM). It is a low-molecular-weight (MW = 478) and peptide-like collagen substrate analogue consisting of a peptide backbone and a hydroxamic acid group which bind to MMPs and the catalytically active zinc atom respectively.
Trivial name | Batimastat (BB-94) 25mg |
Catalog Number | A12985-25 |
Alternative Name(s) | (2R,3S)-N4-Hydroxy-N1-[(1S)-2-(meth?ylamino)-2-oxo-1-(phenylmethyl)ethyl]-2-(2-methylp?ropyl)-3-[(2-thienylthio)methyl]butanediamide |
Molecular Formula | C23H31N3O4S2 |
CAS# | 130370-60-4 |
SMILES | CC(C)C[C@H]([C@H](CSC1=CC=CS1)C(=O)NO)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)NC |
Size | 25mg |
Supplier Page | http://www.adooq.com/batimastat-bb-94.html |